C17H25N3O3 — CID 75461257
1-methyl-4-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyridin-2-one (PubChem CID 75461257) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-methyl-4-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyridin-2-one.
| Compound Name | 1-methyl-4-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 75461257 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-methyl-4-[4-(morpholin-4-ylmethyl)piperidine-1-carbonyl]pyridin-2-one |
| SMILES | Cn1ccc(C(=O)N2CCC(CN3CCOCC3)CC2)cc1=O |
| InChI | InChI=1S/C17H25N3O3/c1-18-5-4-15(12-16(18)21)17(22)20-6-2-14(3-7-20)13-19-8-10-23-11-9-19/h4-5,12,14H,2-3,6-11,13H2,1H3 |
| InChIKey | WUEGCCLBTNKYLZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |