C16H19F2N3O2 — CID 125147070
(3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,5-difluorophenyl)pyrrolidin-2-one (PubChem CID 125147070) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,5-difluorophenyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,5-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 125147070 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3S)-3-[(3R)-3-(aminomethyl)pyrrolidine-1-carbonyl]-1-(3,5-difluorophenyl)pyrrolidin-2-one |
| SMILES | NC[C@H]1CCN(C(=O)[C@@H]2CCN(c3cc(F)cc(F)c3)C2=O)C1 |
| InChI | InChI=1S/C16H19F2N3O2/c17-11-5-12(18)7-13(6-11)21-4-2-14(16(21)23)15(22)20-3-1-10(8-19)9-20/h5-7,10,14H,1-4,8-9,19H2/t10-,14+/m1/s1 |
| InChIKey | TZNAEQLFRAKLHA-YGRLFVJLSA-N |
| XLogP | 1.12 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|