C16H16F2N2O5 — CID 125152682
(2R)-4-[(3S)-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 125152682) has the molecular formula C16H16F2N2O5 and a molecular weight of 354.31 g/mol. Its IUPAC name is (2R)-4-[(3S)-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[(3S)-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125152682 |
| Molecular Formula | C16H16F2N2O5 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2R)-4-[(3S)-1-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)[C@@H]2CCN(c3cc(F)cc(F)c3)C2=O)CCO1 |
| InChI | InChI=1S/C16H16F2N2O5/c17-9-5-10(18)7-11(6-9)20-2-1-12(15(20)22)14(21)19-3-4-25-13(8-19)16(23)24/h5-7,12-13H,1-4,8H2,(H,23,24)/t12-,13+/m0/s1 |
| InChIKey | PVHTYQVFJDJRRD-QWHCGFSZSA-N |
| XLogP | 0.63 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|