C15H19BrClN3O2 — CID 119412734
3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(2-bromophenyl)pyrrolidin-2-one;hydrochloride (PubChem CID 119412734) has the molecular formula C15H19BrClN3O2 and a molecular weight of 388.69 g/mol. Its IUPAC name is 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(2-bromophenyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(2-bromophenyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119412734 |
| Molecular Formula | C15H19BrClN3O2 |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 3-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-(2-bromophenyl)pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)C2CCN(c3ccccc3Br)C2=O)C1 |
| InChI | InChI=1S/C15H18BrN3O2.ClH/c16-12-3-1-2-4-13(12)19-8-6-11(15(19)21)14(20)18-7-5-10(17)9-18;/h1-4,10-11H,5-9,17H2;1H/t10-,11?;/m1./s1 |
| InChIKey | OSSGLAUWZCFFCK-QUUNXCOLSA-N |
| XLogP | 1.78 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|