C17H22BrN3O2 — CID 78887013
1-(2-bromophenyl)-3-(4-methyl-1,4-diazepane-1-carbonyl)pyrrolidin-2-one (PubChem CID 78887013) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(4-methyl-1,4-diazepane-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(2-bromophenyl)-3-(4-methyl-1,4-diazepane-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 78887013 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(2-bromophenyl)-3-(4-methyl-1,4-diazepane-1-carbonyl)pyrrolidin-2-one |
| SMILES | CN1CCCN(C(=O)C2CCN(c3ccccc3Br)C2=O)CC1 |
| InChI | InChI=1S/C17H22BrN3O2/c1-19-8-4-9-20(12-11-19)16(22)13-7-10-21(17(13)23)15-6-3-2-5-14(15)18/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | VBSVLZQNUXCJOZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|