C17H22Cl2N2O4S — CID 86946017
1-(3,4-dichlorophenyl)-N-(1-ethylsulfonylpropan-2-yl)-N-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 86946017) has the molecular formula C17H22Cl2N2O4S and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-(1-ethylsulfonylpropan-2-yl)-N-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-(1-ethylsulfonylpropan-2-yl)-N-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86946017 |
| Molecular Formula | C17H22Cl2N2O4S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-(1-ethylsulfonylpropan-2-yl)-N-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CCS(=O)(=O)CC(C)N(C)C(=O)C1CCN(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H22Cl2N2O4S/c1-4-26(24,25)10-11(2)20(3)16(22)13-7-8-21(17(13)23)12-5-6-14(18)15(19)9-12/h5-6,9,11,13H,4,7-8,10H2,1-3H3 |
| InChIKey | UVYCAYHGWCMLAO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|