1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid

C13H14Cl2N2O3 — CID 61185284

IUPAC1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1C(=O)Nc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C13H14Cl2N2O3/c14-8-5-9(15)7-10(6-8)16-13(20)17-4-2-1-3-11(17)12(18)19/h5-7,11H,1-4H2,(H,16,20)(H,18,19)
InChIKeyOKMXQFQCYQLTDO-UHFFFAOYSA-N
MW317.17 g/mol
LogP3.46
Rot. Bonds2

About 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid

1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid (PubChem CID 61185284) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid
PubChem CID61185284
Molecular FormulaC13H14Cl2N2O3
Molecular Weight317.17 g/mol
Exact Mass316.04
IUPAC Name1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1C(=O)Nc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C13H14Cl2N2O3/c14-8-5-9(15)7-10(6-8)16-13(20)17-4-2-1-3-11(17)12(18)19/h5-7,11H,1-4H2,(H,16,20)(H,18,19)
InChIKeyOKMXQFQCYQLTDO-UHFFFAOYSA-N
XLogP3.46
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.17
LogP ≤ 53.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid?
The IUPAC name of 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid (CID 61185284) is 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid?
The canonical SMILES for 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid is O=C(O)C1CCCCN1C(=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid?
The InChIKey is OKMXQFQCYQLTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O3/c14-8-5-9(15)7-10(6-8)16-13(20)17-4-2-1-3-11(17)12(18)19/h5-7,11H,1-4H2,(H,16,20)(H,18,19).
What are the key properties of 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid?
1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid has a molecular weight of 317.17 g/mol, XLogP of 3.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichlorophenyl)carbamoyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 61185284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).