C13H13Cl2FN2O3 — CID 107576495
1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]piperidine-2-carboxylic acid (PubChem CID 107576495) has the molecular formula C13H13Cl2FN2O3 and a molecular weight of 335.16 g/mol. Its IUPAC name is 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107576495 |
| Molecular Formula | C13H13Cl2FN2O3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2FN2O3/c14-8-5-7(6-9(15)11(8)16)17-13(21)18-4-2-1-3-10(18)12(19)20/h5-6,10H,1-4H2,(H,17,21)(H,19,20) |
| InChIKey | AIEKGIPMZLOUOL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|