C12H11Cl2FN2O3 — CID 107576464
1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 107576464) has the molecular formula C12H11Cl2FN2O3 and a molecular weight of 321.14 g/mol. Its IUPAC name is 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107576464 |
| Molecular Formula | C12H11Cl2FN2O3 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 1-[(3,5-dichloro-4-fluorophenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2FN2O3/c13-7-4-6(5-8(14)10(7)15)16-12(20)17-3-1-2-9(17)11(18)19/h4-5,9H,1-3H2,(H,16,20)(H,18,19) |
| InChIKey | KGERMWIVBITKNC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|