C15H25N3OS2 — CID 5128441
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)undec-10-enamide (PubChem CID 5128441) has the molecular formula C15H25N3OS2 and a molecular weight of 327.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)undec-10-enamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)undec-10-enamide |
|---|---|
| PubChem CID | 5128441 |
| Molecular Formula | C15H25N3OS2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)Nc1nnc(SCC)s1 |
| InChI | InChI=1S/C15H25N3OS2/c1-3-5-6-7-8-9-10-11-12-13(19)16-14-17-18-15(21-14)20-4-2/h3H,1,4-12H2,2H3,(H,16,17,19) |
| InChIKey | SRYCNQYRODIFNE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|