C24H42N4OS — CID 509889
N-[5-(cyclobutylamino)-1,3,4-thiadiazol-2-yl]octadec-9-enamide (PubChem CID 509889) has the molecular formula C24H42N4OS and a molecular weight of 434.69 g/mol. Its IUPAC name is N-[5-(cyclobutylamino)-1,3,4-thiadiazol-2-yl]octadec-9-enamide.
| Compound Name | N-[5-(cyclobutylamino)-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 509889 |
| Molecular Formula | C24H42N4OS |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | N-[5-(cyclobutylamino)-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Nc1nnc(NC2CCC2)s1 |
| InChI | InChI=1S/C24H42N4OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-22(29)26-24-28-27-23(30-24)25-21-18-17-19-21/h9-10,21H,2-8,11-20H2,1H3,(H,25,27)(H,26,28,29) |
| InChIKey | WDNBRAQQCOJCMH-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|