C26H45N5O3S — CID 70107715
4-[[5-[[(E)-octadec-9-enoyl]amino]-1,3,4-thiadiazol-2-yl]amino]piperidine-1-carboxylic acid (PubChem CID 70107715) has the molecular formula C26H45N5O3S and a molecular weight of 507.75 g/mol. Its IUPAC name is 4-[[5-[[(E)-octadec-9-enoyl]amino]-1,3,4-thiadiazol-2-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[5-[[(E)-octadec-9-enoyl]amino]-1,3,4-thiadiazol-2-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 70107715 |
| Molecular Formula | C26H45N5O3S |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 4-[[5-[[(E)-octadec-9-enoyl]amino]-1,3,4-thiadiazol-2-yl]amino]piperidine-1-carboxylic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)Nc1nnc(NC2CCN(C(=O)O)CC2)s1 |
| InChI | InChI=1S/C26H45N5O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(32)28-25-30-29-24(35-25)27-22-18-20-31(21-19-22)26(33)34/h9-10,22H,2-8,11-21H2,1H3,(H,27,29)(H,33,34)(H,28,30,32)/b10-9+ |
| InChIKey | JAUGGKSOICGWLC-MDZDMXLPSA-N |
| XLogP | 7.07 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|