C29H53N5OS — CID 6478782
(E)-N-[5-[3-(cyclohexylamino)propylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide (PubChem CID 6478782) has the molecular formula C29H53N5OS and a molecular weight of 519.84 g/mol. Its IUPAC name is (E)-N-[5-[3-(cyclohexylamino)propylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide.
| Compound Name | (E)-N-[5-[3-(cyclohexylamino)propylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 6478782 |
| Molecular Formula | C29H53N5OS |
| Molecular Weight | 519.84 g/mol |
| Exact Mass | 519.40 |
| IUPAC Name | (E)-N-[5-[3-(cyclohexylamino)propylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)Nc1nnc(NCCCNC2CCCCC2)s1 |
| InChI | InChI=1S/C29H53N5OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-23-27(35)32-29-34-33-28(36-29)31-25-20-24-30-26-21-17-16-18-22-26/h9-10,26,30H,2-8,11-25H2,1H3,(H,31,33)(H,32,34,35)/b10-9+ |
| InChIKey | LSAFPFDLHJBUGJ-MDZDMXLPSA-N |
| XLogP | 8.24 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.84 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|