C29H46N4O3S — CID 6478811
(E)-N-[5-[(3,4-dimethoxyphenyl)methylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide (PubChem CID 6478811) has the molecular formula C29H46N4O3S and a molecular weight of 530.78 g/mol. Its IUPAC name is (E)-N-[5-[(3,4-dimethoxyphenyl)methylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide.
| Compound Name | (E)-N-[5-[(3,4-dimethoxyphenyl)methylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 6478811 |
| Molecular Formula | C29H46N4O3S |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | (E)-N-[5-[(3,4-dimethoxyphenyl)methylamino]-1,3,4-thiadiazol-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)Nc1nnc(NCc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C29H46N4O3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(34)31-29-33-32-28(37-29)30-23-24-20-21-25(35-2)26(22-24)36-3/h11-12,20-22H,4-10,13-19,23H2,1-3H3,(H,30,32)(H,31,33,34)/b12-11+ |
| InChIKey | SFMLVLDGNJVOAA-VAWYXSNFSA-N |
| XLogP | 8.14 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|