C11H17N3O2S — CID 19183928
N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 19183928) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 19183928 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(C2CCCO2)s1 |
| InChI | InChI=1S/C11H17N3O2S/c1-2-3-6-9(15)12-11-14-13-10(17-11)8-5-4-7-16-8/h8H,2-7H2,1H3,(H,12,14,15) |
| InChIKey | JYTSRQGSVMVIKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |