C10H13N3O2S — CID 110459746
(E)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]but-2-enamide (PubChem CID 110459746) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is (E)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]but-2-enamide.
| Compound Name | (E)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 110459746 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (E)-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1nnc(C2CCCO2)s1 |
| InChI | InChI=1S/C10H13N3O2S/c1-2-4-8(14)11-10-13-12-9(16-10)7-5-3-6-15-7/h2,4,7H,3,5-6H2,1H3,(H,11,13,14)/b4-2+ |
| InChIKey | UINGLWAKHWLXPG-DUXPYHPUSA-N |
| XLogP | 1.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|