C21H24N4O4S3 — CID 100763442
(2S)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-methoxy-N-methylsulfonylanilino)butanamide (PubChem CID 100763442) has the molecular formula C21H24N4O4S3 and a molecular weight of 492.65 g/mol. Its IUPAC name is (2S)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-methoxy-N-methylsulfonylanilino)butanamide.
| Compound Name | (2S)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-methoxy-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 100763442 |
| Molecular Formula | C21H24N4O4S3 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (2S)-N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(3-methoxy-N-methylsulfonylanilino)butanamide |
| SMILES | CC[C@@H](C(=O)Nc1nnc(SCc2ccccc2)s1)N(c1cccc(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H24N4O4S3/c1-4-18(25(32(3,27)28)16-11-8-12-17(13-16)29-2)19(26)22-20-23-24-21(31-20)30-14-15-9-6-5-7-10-15/h5-13,18H,4,14H2,1-3H3,(H,22,23,26)/t18-/m0/s1 |
| InChIKey | JXGMHOHCRBMQDV-SFHVURJKSA-N |
| XLogP | 4.02 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|