C15H19N5O5S3 — CID 133184704
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide (PubChem CID 133184704) has the molecular formula C15H19N5O5S3 and a molecular weight of 445.55 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide |
|---|---|
| PubChem CID | 133184704 |
| Molecular Formula | C15H19N5O5S3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide |
| SMILES | CCSc1nnc(NC(=O)C(CC)N(c2cccc([N+](=O)[O-])c2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H19N5O5S3/c1-4-12(13(21)16-14-17-18-15(27-14)26-5-2)19(28(3,24)25)10-7-6-8-11(9-10)20(22)23/h6-9,12H,4-5H2,1-3H3,(H,16,17,21) |
| InChIKey | RAPSNHATLXHAFT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|