C19H21N3O7S — CID 132670494
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide (PubChem CID 132670494) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide |
|---|---|
| PubChem CID | 132670494 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(N-methylsulfonyl-3-nitroanilino)butanamide |
| SMILES | CCC(C(=O)Nc1ccc2c(c1)OCCO2)N(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H21N3O7S/c1-3-16(19(23)20-13-7-8-17-18(11-13)29-10-9-28-17)21(30(2,26)27)14-5-4-6-15(12-14)22(24)25/h4-8,11-12,16H,3,9-10H2,1-2H3,(H,20,23) |
| InChIKey | ZUZGVCZCDUBRDH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|