C12H11Cl2N3O2 — CID 70585868
ethyl 3-amino-2-cyano-3-(3,4-dichloroanilino)prop-2-enoate (PubChem CID 70585868) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is ethyl 3-amino-2-cyano-3-(3,4-dichloroanilino)prop-2-enoate.
| Compound Name | ethyl 3-amino-2-cyano-3-(3,4-dichloroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 70585868 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | ethyl 3-amino-2-cyano-3-(3,4-dichloroanilino)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(N)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-2-19-12(18)8(6-15)11(16)17-7-3-4-9(13)10(14)5-7/h3-5,17H,2,16H2,1H3 |
| InChIKey | SGHALDZXNBOQIC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|