C27H26N4O5 — CID 135448157
ethyl 3-[[4-[(2,2-diphenylacetyl)amino]benzoyl]hydrazinylidene]-2-hydroxyiminobutanoate (PubChem CID 135448157) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 3-[[4-[(2,2-diphenylacetyl)amino]benzoyl]hydrazinylidene]-2-hydroxyiminobutanoate.
| Compound Name | ethyl 3-[[4-[(2,2-diphenylacetyl)amino]benzoyl]hydrazinylidene]-2-hydroxyiminobutanoate |
|---|---|
| PubChem CID | 135448157 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | ethyl 3-[[4-[(2,2-diphenylacetyl)amino]benzoyl]hydrazinylidene]-2-hydroxyiminobutanoate |
| SMILES | CCOC(=O)C(=NO)C(C)=NNC(=O)c1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N4O5/c1-3-36-27(34)24(31-35)18(2)29-30-25(32)21-14-16-22(17-15-21)28-26(33)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17,23,35H,3H2,1-2H3,(H,28,33)(H,30,32) |
| InChIKey | HKTKOEOHDYACBN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|