C13H13Cl2NO3 — CID 71393577
N-(3,4-dichlorophenyl)-2-(ethoxymethylidene)-3-oxobutanamide (PubChem CID 71393577) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(ethoxymethylidene)-3-oxobutanamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(ethoxymethylidene)-3-oxobutanamide |
|---|---|
| PubChem CID | 71393577 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(ethoxymethylidene)-3-oxobutanamide |
| SMILES | CCOC=C(C(C)=O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-3-19-7-10(8(2)17)13(18)16-9-4-5-11(14)12(15)6-9/h4-7H,3H2,1-2H3,(H,16,18) |
| InChIKey | ODRMLQDLKQZGQR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|