C14H17Cl2NO — CID 134122899
(E)-N-(3,4-dichlorophenyl)-2-ethylhex-2-enamide (PubChem CID 134122899) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is (E)-N-(3,4-dichlorophenyl)-2-ethylhex-2-enamide.
| Compound Name | (E)-N-(3,4-dichlorophenyl)-2-ethylhex-2-enamide |
|---|---|
| PubChem CID | 134122899 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (E)-N-(3,4-dichlorophenyl)-2-ethylhex-2-enamide |
| SMILES | CCC/C=C(\CC)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO/c1-3-5-6-10(4-2)14(18)17-11-7-8-12(15)13(16)9-11/h6-9H,3-5H2,1-2H3,(H,17,18)/b10-6+ |
| InChIKey | GUTFOLFAZUONQQ-UXBLZVDNSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|