C15H16N2O8 — CID 23451570
3,4-bis[(2-ethoxy-2-oxoacetyl)amino]benzoic acid (PubChem CID 23451570) has the molecular formula C15H16N2O8 and a molecular weight of 352.30 g/mol. Its IUPAC name is 3,4-bis[(2-ethoxy-2-oxoacetyl)amino]benzoic acid.
| Compound Name | 3,4-bis[(2-ethoxy-2-oxoacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 23451570 |
| Molecular Formula | C15H16N2O8 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3,4-bis[(2-ethoxy-2-oxoacetyl)amino]benzoic acid |
| SMILES | CCOC(=O)C(=O)Nc1ccc(C(=O)O)cc1NC(=O)C(=O)OCC |
| InChI | InChI=1S/C15H16N2O8/c1-3-24-14(22)11(18)16-9-6-5-8(13(20)21)7-10(9)17-12(19)15(23)25-4-2/h5-7H,3-4H2,1-2H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | MMSXYYBPPJYIBT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|