C17H18ClN3O4 — CID 108532284
N'-(2-amino-5-methylphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)oxamide (PubChem CID 108532284) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is N'-(2-amino-5-methylphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)oxamide.
| Compound Name | N'-(2-amino-5-methylphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108532284 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N'-(2-amino-5-methylphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cc(C)ccc2N)c(OC)cc1Cl |
| InChI | InChI=1S/C17H18ClN3O4/c1-9-4-5-11(19)12(6-9)20-16(22)17(23)21-13-8-14(24-2)10(18)7-15(13)25-3/h4-8H,19H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | DFPICFNPGXWAED-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|