C13H14Cl2N4O — CID 104620466
1-(2,5-dichlorophenyl)-3-(5-propan-2-yl-1H-pyrazol-3-yl)urea (PubChem CID 104620466) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(5-propan-2-yl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(5-propan-2-yl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 104620466 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(5-propan-2-yl-1H-pyrazol-3-yl)urea |
| SMILES | CC(C)c1cc(NC(=O)Nc2cc(Cl)ccc2Cl)n[nH]1 |
| InChI | InChI=1S/C13H14Cl2N4O/c1-7(2)10-6-12(19-18-10)17-13(20)16-11-5-8(14)3-4-9(11)15/h3-7H,1-2H3,(H3,16,17,18,19,20) |
| InChIKey | UKHSNBJQIYRPQF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |