C8H9BrClN3O2 — CID 110010971
1-(5-bromo-4-chloro-3-pyridinyl)-3-(2-hydroxyethyl)urea (PubChem CID 110010971) has the molecular formula C8H9BrClN3O2 and a molecular weight of 294.54 g/mol. Its IUPAC name is 1-(5-bromo-4-chloro-3-pyridinyl)-3-(2-hydroxyethyl)urea.
| Compound Name | 1-(5-bromo-4-chloro-3-pyridinyl)-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110010971 |
| Molecular Formula | C8H9BrClN3O2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 1-(5-bromo-4-chloro-3-pyridinyl)-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1cncc(Br)c1Cl |
| InChI | InChI=1S/C8H9BrClN3O2/c9-5-3-11-4-6(7(5)10)13-8(15)12-1-2-14/h3-4,14H,1-2H2,(H2,12,13,15) |
| InChIKey | XJSIJPNQONGZQS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |