C11H15BrN2O3 — CID 110930838
1-(5-bromo-2-ethoxyphenyl)-3-(2-hydroxyethyl)urea (PubChem CID 110930838) has the molecular formula C11H15BrN2O3 and a molecular weight of 303.16 g/mol. Its IUPAC name is 1-(5-bromo-2-ethoxyphenyl)-3-(2-hydroxyethyl)urea.
| Compound Name | 1-(5-bromo-2-ethoxyphenyl)-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110930838 |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-(5-bromo-2-ethoxyphenyl)-3-(2-hydroxyethyl)urea |
| SMILES | CCOc1ccc(Br)cc1NC(=O)NCCO |
| InChI | InChI=1S/C11H15BrN2O3/c1-2-17-10-4-3-8(12)7-9(10)14-11(16)13-5-6-15/h3-4,7,15H,2,5-6H2,1H3,(H2,13,14,16) |
| InChIKey | FPYKVCRMVVRDMB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |