C9H9BrF3N3O3 — CID 167988054
1-[5-bromo-6-(trifluoromethoxy)-2-pyridinyl]-3-(2-hydroxyethyl)urea (PubChem CID 167988054) has the molecular formula C9H9BrF3N3O3 and a molecular weight of 344.09 g/mol. Its IUPAC name is 1-[5-bromo-6-(trifluoromethoxy)-2-pyridinyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[5-bromo-6-(trifluoromethoxy)-2-pyridinyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 167988054 |
| Molecular Formula | C9H9BrF3N3O3 |
| Molecular Weight | 344.09 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 1-[5-bromo-6-(trifluoromethoxy)-2-pyridinyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1ccc(Br)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C9H9BrF3N3O3/c10-5-1-2-6(16-8(18)14-3-4-17)15-7(5)19-9(11,12)13/h1-2,17H,3-4H2,(H2,14,15,16,18) |
| InChIKey | TVQZVAZMNABOIQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.09 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |