C13H18BrN3O3 — CID 126831123
1-(2-bromo-5-morpholin-4-ylphenyl)-3-(2-hydroxyethyl)urea (PubChem CID 126831123) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 1-(2-bromo-5-morpholin-4-ylphenyl)-3-(2-hydroxyethyl)urea.
| Compound Name | 1-(2-bromo-5-morpholin-4-ylphenyl)-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 126831123 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(2-bromo-5-morpholin-4-ylphenyl)-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1cc(N2CCOCC2)ccc1Br |
| InChI | InChI=1S/C13H18BrN3O3/c14-11-2-1-10(17-4-7-20-8-5-17)9-12(11)16-13(19)15-3-6-18/h1-2,9,18H,3-8H2,(H2,15,16,19) |
| InChIKey | CSNUGYUGMXCOGO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |