C18H19BrN2O3 — CID 110359755
2-bromo-N-(2-methoxy-5-morpholin-4-ylphenyl)benzamide (PubChem CID 110359755) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 2-bromo-N-(2-methoxy-5-morpholin-4-ylphenyl)benzamide.
| Compound Name | 2-bromo-N-(2-methoxy-5-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 110359755 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-bromo-N-(2-methoxy-5-morpholin-4-ylphenyl)benzamide |
| SMILES | COc1ccc(N2CCOCC2)cc1NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H19BrN2O3/c1-23-17-7-6-13(21-8-10-24-11-9-21)12-16(17)20-18(22)14-4-2-3-5-15(14)19/h2-7,12H,8-11H2,1H3,(H,20,22) |
| InChIKey | LWBLGHGFGZFITP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|