C20H21N5O3 — CID 131922121
N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-morpholin-4-ylbenzamide (PubChem CID 131922121) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 131922121 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-methoxy-5-(1,2,4-triazol-4-yl)phenyl]-2-morpholin-4-ylbenzamide |
| SMILES | COc1ccc(-n2cnnc2)cc1NC(=O)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H21N5O3/c1-27-19-7-6-15(25-13-21-22-14-25)12-17(19)23-20(26)16-4-2-3-5-18(16)24-8-10-28-11-9-24/h2-7,12-14H,8-11H2,1H3,(H,23,26) |
| InChIKey | DXRBVEJMSUCIEA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |