C13H18BrN3O3 — CID 126831122
1-(2-bromo-5-morpholin-4-ylphenyl)-3-ethoxyurea (PubChem CID 126831122) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 1-(2-bromo-5-morpholin-4-ylphenyl)-3-ethoxyurea.
| Compound Name | 1-(2-bromo-5-morpholin-4-ylphenyl)-3-ethoxyurea |
|---|---|
| PubChem CID | 126831122 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(2-bromo-5-morpholin-4-ylphenyl)-3-ethoxyurea |
| SMILES | CCONC(=O)Nc1cc(N2CCOCC2)ccc1Br |
| InChI | InChI=1S/C13H18BrN3O3/c1-2-20-16-13(18)15-12-9-10(3-4-11(12)14)17-5-7-19-8-6-17/h3-4,9H,2,5-8H2,1H3,(H2,15,16,18) |
| InChIKey | QLIQMEOWYCHIOJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|