C12H13Cl2FN2O3S — CID 107576373
(2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 107576373) has the molecular formula C12H13Cl2FN2O3S and a molecular weight of 355.22 g/mol. Its IUPAC name is (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107576373 |
| Molecular Formula | C12H13Cl2FN2O3S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | (2S)-2-[(3,5-dichloro-4-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1cc(Cl)c(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H13Cl2FN2O3S/c1-21-3-2-9(11(18)19)17-12(20)16-6-4-7(13)10(15)8(14)5-6/h4-5,9H,2-3H2,1H3,(H,18,19)(H2,16,17,20)/t9-/m0/s1 |
| InChIKey | HUIPFYRFQRFNQY-VIFPVBQESA-N |
| XLogP | 3.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|