C12H14ClFN2O3S — CID 107368633
(2S)-2-[(3-chloro-5-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 107368633) has the molecular formula C12H14ClFN2O3S and a molecular weight of 320.77 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-5-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(3-chloro-5-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107368633 |
| Molecular Formula | C12H14ClFN2O3S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (2S)-2-[(3-chloro-5-fluorophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1cc(F)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H14ClFN2O3S/c1-20-3-2-10(11(17)18)16-12(19)15-9-5-7(13)4-8(14)6-9/h4-6,10H,2-3H2,1H3,(H,17,18)(H2,15,16,19)/t10-/m0/s1 |
| InChIKey | GNFUAYAOAXXENZ-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |