C15H11Cl2N3O — CID 62105248
1-(5-cyano-2-methylphenyl)-3-(2,5-dichlorophenyl)urea (PubChem CID 62105248) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 1-(5-cyano-2-methylphenyl)-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-(5-cyano-2-methylphenyl)-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 62105248 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-(5-cyano-2-methylphenyl)-3-(2,5-dichlorophenyl)urea |
| SMILES | Cc1ccc(C#N)cc1NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2N3O/c1-9-2-3-10(8-18)6-13(9)19-15(21)20-14-7-11(16)4-5-12(14)17/h2-7H,1H3,(H2,19,20,21) |
| InChIKey | NRLKUGHNRULNFC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |