C14H11Cl2N3O3 — CID 5122789
1-(2,5-dichlorophenyl)-3-(2-methyl-5-nitrophenyl)urea (PubChem CID 5122789) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(2-methyl-5-nitrophenyl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(2-methyl-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 5122789 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(2-methyl-5-nitrophenyl)urea |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3/c1-8-2-4-10(19(21)22)7-12(8)17-14(20)18-13-6-9(15)3-5-11(13)16/h2-7H,1H3,(H2,17,18,20) |
| InChIKey | HQEYHEZWULPSTO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|