C14H10Cl2N4O — CID 107652968
1-(4-amino-2-cyanophenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107652968) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is 1-(4-amino-2-cyanophenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(4-amino-2-cyanophenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107652968 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(4-amino-2-cyanophenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | N#Cc1cc(N)ccc1NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N4O/c15-9-4-10(16)6-12(5-9)19-14(21)20-13-2-1-11(18)3-8(13)7-17/h1-6H,18H2,(H2,19,20,21) |
| InChIKey | MOLOUTGIKMIQFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|