C15H17Cl2N3O — CID 107653440
1-[cyano(cyclohexyl)methyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 107653440) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is 1-[cyano(cyclohexyl)methyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[cyano(cyclohexyl)methyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107653440 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-[cyano(cyclohexyl)methyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | N#CC(NC(=O)Nc1cc(Cl)cc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H17Cl2N3O/c16-11-6-12(17)8-13(7-11)19-15(21)20-14(9-18)10-4-2-1-3-5-10/h6-8,10,14H,1-5H2,(H2,19,20,21) |
| InChIKey | CAHNGNWKIBLVIO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |