C10H16N2O2 — CID 61124825
methyl N-[cyano(cyclohexyl)methyl]carbamate (PubChem CID 61124825) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl N-[cyano(cyclohexyl)methyl]carbamate.
| Compound Name | methyl N-[cyano(cyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 61124825 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | methyl N-[cyano(cyclohexyl)methyl]carbamate |
| SMILES | COC(=O)NC(C#N)C1CCCCC1 |
| InChI | InChI=1S/C10H16N2O2/c1-14-10(13)12-9(7-11)8-5-3-2-4-6-8/h8-9H,2-6H2,1H3,(H,12,13) |
| InChIKey | IZEAEUIKDLRKMB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |