C15H13BrF2N2O — CID 108901812
1-[2-(3-bromophenyl)ethyl]-3-(2,5-difluorophenyl)urea (PubChem CID 108901812) has the molecular formula C15H13BrF2N2O and a molecular weight of 355.18 g/mol. Its IUPAC name is 1-[2-(3-bromophenyl)ethyl]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[2-(3-bromophenyl)ethyl]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 108901812 |
| Molecular Formula | C15H13BrF2N2O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 1-[2-(3-bromophenyl)ethyl]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(NCCc1cccc(Br)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H13BrF2N2O/c16-11-3-1-2-10(8-11)6-7-19-15(21)20-14-9-12(17)4-5-13(14)18/h1-5,8-9H,6-7H2,(H2,19,20,21) |
| InChIKey | NZBCKJACGHITOC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |