C15H14BrFN2O2 — CID 61339972
1-(5-bromo-2-fluorophenyl)-3-[3-(1-hydroxyethyl)phenyl]urea (PubChem CID 61339972) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-3-[3-(1-hydroxyethyl)phenyl]urea.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-3-[3-(1-hydroxyethyl)phenyl]urea |
|---|---|
| PubChem CID | 61339972 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-3-[3-(1-hydroxyethyl)phenyl]urea |
| SMILES | CC(O)c1cccc(NC(=O)Nc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C15H14BrFN2O2/c1-9(20)10-3-2-4-12(7-10)18-15(21)19-14-8-11(16)5-6-13(14)17/h2-9,20H,1H3,(H2,18,19,21) |
| InChIKey | NKSWTKCRURPOJX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |