C19H22BrClN4O4S2 — CID 20612317
1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfamoyl]phenyl]thiourea (PubChem CID 20612317) has the molecular formula C19H22BrClN4O4S2 and a molecular weight of 549.90 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 20612317 |
| Molecular Formula | C19H22BrClN4O4S2 |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-[[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfamoyl]phenyl]thiourea |
| SMILES | COC[C@@H]1CCCN1NS(=O)(=O)c1c(Cl)ccc(NC(=S)Nc2ccccc2Br)c1O |
| InChI | InChI=1S/C19H22BrClN4O4S2/c1-29-11-12-5-4-10-25(12)24-31(27,28)18-14(21)8-9-16(17(18)26)23-19(30)22-15-7-3-2-6-13(15)20/h2-3,6-9,12,24,26H,4-5,10-11H2,1H3,(H2,22,23,30)/t12-/m0/s1 |
| InChIKey | YJTWBIOYPFPTJF-LBPRGKRZSA-N |
| XLogP | 3.92 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|