C19H18BrClFN4O5S2- — CID 87432728
N-[3-[(2-bromo-3-fluorophenyl)carbamothioylamino]-6-chloro-2-hydroxyphenyl]sulfonyl-1-oxidopiperidine-4-carboxamide (PubChem CID 87432728) has the molecular formula C19H18BrClFN4O5S2- and a molecular weight of 580.87 g/mol. Its IUPAC name is N-[3-[(2-bromo-3-fluorophenyl)carbamothioylamino]-6-chloro-2-hydroxyphenyl]sulfonyl-1-oxidopiperidine-4-carboxamide.
| Compound Name | N-[3-[(2-bromo-3-fluorophenyl)carbamothioylamino]-6-chloro-2-hydroxyphenyl]sulfonyl-1-oxidopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 87432728 |
| Molecular Formula | C19H18BrClFN4O5S2- |
| Molecular Weight | 580.87 g/mol |
| Exact Mass | 578.96 |
| IUPAC Name | N-[3-[(2-bromo-3-fluorophenyl)carbamothioylamino]-6-chloro-2-hydroxyphenyl]sulfonyl-1-oxidopiperidine-4-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1c(Cl)ccc(NC(=S)Nc2cccc(F)c2Br)c1O)C1CCN([O-])CC1 |
| InChI | InChI=1S/C19H18BrClFN4O5S2/c20-15-12(22)2-1-3-13(15)23-19(32)24-14-5-4-11(21)17(16(14)27)33(30,31)25-18(28)10-6-8-26(29)9-7-10/h1-5,10,27H,6-9H2,(H,25,28)(H2,23,24,32)/q-1 |
| InChIKey | ZXJCLRBQCOCMOY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|