C13H14ClF2NO3S — CID 139002220
N-(6-chloro-2,3-difluorophenyl)sulfonyl-3-methylcyclopentane-1-carboxamide (PubChem CID 139002220) has the molecular formula C13H14ClF2NO3S and a molecular weight of 337.78 g/mol. Its IUPAC name is N-(6-chloro-2,3-difluorophenyl)sulfonyl-3-methylcyclopentane-1-carboxamide.
| Compound Name | N-(6-chloro-2,3-difluorophenyl)sulfonyl-3-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 139002220 |
| Molecular Formula | C13H14ClF2NO3S |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-(6-chloro-2,3-difluorophenyl)sulfonyl-3-methylcyclopentane-1-carboxamide |
| SMILES | CC1CCC(C(=O)NS(=O)(=O)c2c(Cl)ccc(F)c2F)C1 |
| InChI | InChI=1S/C13H14ClF2NO3S/c1-7-2-3-8(6-7)13(18)17-21(19,20)12-9(14)4-5-10(15)11(12)16/h4-5,7-8H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | AVHTXGLSOLQVOR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|