C19H18BrClN6O5S — CID 10120304
1-[[3-[[N'-(2-bromophenyl)-N-cyanocarbamimidoyl]amino]-6-chloro-2-hydroxyphenyl]sulfonylamino]pyrrolidine-2-carboxylic acid (PubChem CID 10120304) has the molecular formula C19H18BrClN6O5S and a molecular weight of 557.81 g/mol. Its IUPAC name is 1-[[3-[[N'-(2-bromophenyl)-N-cyanocarbamimidoyl]amino]-6-chloro-2-hydroxyphenyl]sulfonylamino]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[3-[[N'-(2-bromophenyl)-N-cyanocarbamimidoyl]amino]-6-chloro-2-hydroxyphenyl]sulfonylamino]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10120304 |
| Molecular Formula | C19H18BrClN6O5S |
| Molecular Weight | 557.81 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | 1-[[3-[[N'-(2-bromophenyl)-N-cyanocarbamimidoyl]amino]-6-chloro-2-hydroxyphenyl]sulfonylamino]pyrrolidine-2-carboxylic acid |
| SMILES | N#CN/C(=N\c1ccccc1Br)Nc1ccc(Cl)c(S(=O)(=O)NN2CCCC2C(=O)O)c1O |
| InChI | InChI=1S/C19H18BrClN6O5S/c20-11-4-1-2-5-13(11)24-19(23-10-22)25-14-8-7-12(21)17(16(14)28)33(31,32)26-27-9-3-6-15(27)18(29)30/h1-2,4-5,7-8,15,26,28H,3,6,9H2,(H,29,30)(H2,23,24,25) |
| InChIKey | SFABRYFDXJKPGZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.81 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|