C12H8Cl3NO3S — CID 23275594
2,3,5-trichloro-6-hydroxy-N-phenylbenzenesulfonamide (PubChem CID 23275594) has the molecular formula C12H8Cl3NO3S and a molecular weight of 352.63 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-phenylbenzenesulfonamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 23275594 |
| Molecular Formula | C12H8Cl3NO3S |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl3NO3S/c13-8-6-9(14)11(17)12(10(8)15)20(18,19)16-7-4-2-1-3-5-7/h1-6,16-17H |
| InChIKey | PXCDAADGVTVYBO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|