About 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide
3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide (PubChem CID 146545886) has the molecular formula C14H8Cl2F2N4O3S
and a molecular weight of 421.21 g/mol. Its IUPAC name is 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide |
| PubChem CID | 146545886 |
| Molecular Formula | C14H8Cl2F2N4O3S |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-n2nccn2)c(F)cc1F)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H8Cl2F2N4O3S/c15-7-3-8(16)14(23)13(4-7)26(24,25)21-11-6-12(10(18)5-9(11)17)22-19-1-2-20-22/h1-6,21,23H |
| InChIKey | YSIWGACJKHBVEP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide?
The IUPAC name of 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide (CID 146545886) is 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide.
What is the SMILES notation for 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide?
The canonical SMILES for 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide is O=S(=O)(Nc1cc(-n2nccn2)c(F)cc1F)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide?
The InChIKey is YSIWGACJKHBVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F2N4O3S/c15-7-3-8(16)14(23)13(4-7)26(24,25)21-11-6-12(10(18)5-9(11)17)22-19-1-2-20-22/h1-6,21,23H.
What are the key properties of 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide?
3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide has a molecular weight of 421.21 g/mol, XLogP of 3.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[2,4-difluoro-5-(triazol-2-yl)phenyl]-2-hydroxybenzenesulfonamide is sourced from PubChem (CID 146545886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).