C18H18BrClN2O6S — CID 167687138
3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(3-hydroxycyclobutyl)-5-methylbenzamide (PubChem CID 167687138) has the molecular formula C18H18BrClN2O6S and a molecular weight of 505.77 g/mol. Its IUPAC name is 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(3-hydroxycyclobutyl)-5-methylbenzamide.
| Compound Name | 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(3-hydroxycyclobutyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 167687138 |
| Molecular Formula | C18H18BrClN2O6S |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(3-hydroxycyclobutyl)-5-methylbenzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)cc(Cl)c2O)c(O)c(C(=O)NC2CC(O)C2)c1 |
| InChI | InChI=1S/C18H18BrClN2O6S/c1-8-2-12(18(26)21-10-6-11(23)7-10)16(24)14(3-8)22-29(27,28)15-5-9(19)4-13(20)17(15)25/h2-5,10-11,22-25H,6-7H2,1H3,(H,21,26) |
| InChIKey | WJMGZMHQWLVXKD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|