C16H17BrN2O6S — CID 167611731
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(2-hydroxyethyl)-5-methylbenzamide (PubChem CID 167611731) has the molecular formula C16H17BrN2O6S and a molecular weight of 445.29 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(2-hydroxyethyl)-5-methylbenzamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(2-hydroxyethyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 167611731 |
| Molecular Formula | C16H17BrN2O6S |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-2-hydroxy-N-(2-hydroxyethyl)-5-methylbenzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)ccc2O)c(O)c(C(=O)NCCO)c1 |
| InChI | InChI=1S/C16H17BrN2O6S/c1-9-6-11(16(23)18-4-5-20)15(22)12(7-9)19-26(24,25)14-8-10(17)2-3-13(14)21/h2-3,6-8,19-22H,4-5H2,1H3,(H,18,23) |
| InChIKey | LDNKJRSYALVELN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|